C9H21N3O — CID 123149475
3-N-(2-methoxyethyl)-1-N,1-N-dimethylpyrrolidine-1,3-diamine (PubChem CID 123149475) has the molecular formula C9H21N3O and a molecular weight of 187.29 g/mol. Its IUPAC name is 3-N-(2-methoxyethyl)-1-N,1-N-dimethylpyrrolidine-1,3-diamine.
| Compound Name | 3-N-(2-methoxyethyl)-1-N,1-N-dimethylpyrrolidine-1,3-diamine |
|---|---|
| PubChem CID | 123149475 |
| Molecular Formula | C9H21N3O |
| Molecular Weight | 187.29 g/mol |
| Exact Mass | 187.17 |
| IUPAC Name | 3-N-(2-methoxyethyl)-1-N,1-N-dimethylpyrrolidine-1,3-diamine |
| SMILES | COCCNC1CCN(N(C)C)C1 |
| InChI | InChI=1S/C9H21N3O/c1-11(2)12-6-4-9(8-12)10-5-7-13-3/h9-10H,4-8H2,1-3H3 |
| InChIKey | RLLFMMARRQLCGU-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 27.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.29 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|