About tert-butyl 2,3-dimethyl-6-[(2-methyl-3-oxocyclopentylidene)amino]nonanoate
tert-butyl 2,3-dimethyl-6-[(2-methyl-3-oxocyclopentylidene)amino]nonanoate (PubChem CID 123150143) has the molecular formula C21H37NO3
and a molecular weight of 351.53 g/mol. Its IUPAC name is tert-butyl 2,3-dimethyl-6-[(2-methyl-3-oxocyclopentylidene)amino]nonanoate.
Molecular Properties
| Compound Name | tert-butyl 2,3-dimethyl-6-[(2-methyl-3-oxocyclopentylidene)amino]nonanoate |
| PubChem CID | 123150143 |
| Molecular Formula | C21H37NO3 |
| Molecular Weight | 351.53 g/mol |
| Exact Mass | 351.28 |
| IUPAC Name | tert-butyl 2,3-dimethyl-6-[(2-methyl-3-oxocyclopentylidene)amino]nonanoate |
| SMILES | CCCC(CCC(C)C(C)C(=O)OC(C)(C)C)/N=C1\CCC(=O)C1C |
| InChI | InChI=1S/C21H37NO3/c1-8-9-17(22-18-12-13-19(23)16(18)4)11-10-14(2)15(3)20(24)25-21(5,6)7/h14-17H,8-13H2,1-7H3/b22-18+ |
| InChIKey | OQUPGTBQGFVCDW-RELWKKBWSA-N |
| XLogP | 4.99 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.53 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl 2,3-dimethyl-6-[(2-methyl-3-oxocyclopentylidene)amino]nonanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 2,3-dimethyl-6-[(2-methyl-3-oxocyclopentylidene)amino]nonanoate?
The IUPAC name of tert-butyl 2,3-dimethyl-6-[(2-methyl-3-oxocyclopentylidene)amino]nonanoate (CID 123150143) is tert-butyl 2,3-dimethyl-6-[(2-methyl-3-oxocyclopentylidene)amino]nonanoate.
What is the SMILES notation for tert-butyl 2,3-dimethyl-6-[(2-methyl-3-oxocyclopentylidene)amino]nonanoate?
The canonical SMILES for tert-butyl 2,3-dimethyl-6-[(2-methyl-3-oxocyclopentylidene)amino]nonanoate is CCCC(CCC(C)C(C)C(=O)OC(C)(C)C)/N=C1\CCC(=O)C1C.
What is the InChIKey of tert-butyl 2,3-dimethyl-6-[(2-methyl-3-oxocyclopentylidene)amino]nonanoate?
The InChIKey is OQUPGTBQGFVCDW-RELWKKBWSA-N. The full InChI is InChI=1S/C21H37NO3/c1-8-9-17(22-18-12-13-19(23)16(18)4)11-10-14(2)15(3)20(24)25-21(5,6)7/h14-17H,8-13H2,1-7H3/b22-18+.
What are the key properties of tert-butyl 2,3-dimethyl-6-[(2-methyl-3-oxocyclopentylidene)amino]nonanoate?
tert-butyl 2,3-dimethyl-6-[(2-methyl-3-oxocyclopentylidene)amino]nonanoate has a molecular weight of 351.53 g/mol, XLogP of 4.99, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 2,3-dimethyl-6-[(2-methyl-3-oxocyclopentylidene)amino]nonanoate is sourced from PubChem (CID 123150143), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).