C24H19F3NO5S+ — CID 123150236
(2,5-dimethylphenyl) 10-methyl-1-(trifluoromethylsulfonyloxy)acridin-10-ium-9-carboxylate (PubChem CID 123150236) has the molecular formula C24H19F3NO5S+ and a molecular weight of 490.48 g/mol. Its IUPAC name is (2,5-dimethylphenyl) 10-methyl-1-(trifluoromethylsulfonyloxy)acridin-10-ium-9-carboxylate.
| Compound Name | (2,5-dimethylphenyl) 10-methyl-1-(trifluoromethylsulfonyloxy)acridin-10-ium-9-carboxylate |
|---|---|
| PubChem CID | 123150236 |
| Molecular Formula | C24H19F3NO5S+ |
| Molecular Weight | 490.48 g/mol |
| Exact Mass | 490.09 |
| IUPAC Name | (2,5-dimethylphenyl) 10-methyl-1-(trifluoromethylsulfonyloxy)acridin-10-ium-9-carboxylate |
| SMILES | Cc1ccc(C)c(OC(=O)c2c3ccccc3[n+](C)c3cccc(OS(=O)(=O)C(F)(F)F)c23)c1 |
| InChI | InChI=1S/C24H19F3NO5S/c1-14-11-12-15(2)20(13-14)32-23(29)21-16-7-4-5-8-17(16)28(3)18-9-6-10-19(22(18)21)33-34(30,31)24(25,26)27/h4-13H,1-3H3/q+1 |
| InChIKey | YKPAFRDDCOLLQP-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 73.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.48 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|