C13H21N2O+ — CID 123150738
1,8,10-trimethyl-2,3,4,5-tetrahydroazecin-1-ium-7-carboxamide (PubChem CID 123150738) has the molecular formula C13H21N2O+ and a molecular weight of 221.32 g/mol. Its IUPAC name is 1,8,10-trimethyl-2,3,4,5-tetrahydroazecin-1-ium-7-carboxamide.
| Compound Name | 1,8,10-trimethyl-2,3,4,5-tetrahydroazecin-1-ium-7-carboxamide |
|---|---|
| PubChem CID | 123150738 |
| Molecular Formula | C13H21N2O+ |
| Molecular Weight | 221.32 g/mol |
| Exact Mass | 221.16 |
| IUPAC Name | 1,8,10-trimethyl-2,3,4,5-tetrahydroazecin-1-ium-7-carboxamide |
| SMILES | CC1=C/C(C)=[N+](\C)CCCCC=C1C(N)=O |
| InChI | InChI=1S/C13H20N2O/c1-10-9-11(2)15(3)8-6-4-5-7-12(10)13(14)16/h7,9H,4-6,8H2,1-3H3,(H-,14,16)/p+1/b10-9?,12-7?,15-11+ |
| InChIKey | GOCFKYBVYYAKSJ-RXODHXCLSA-O |
| XLogP | 1.63 |
| TPSA | 46.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.32 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|