C14H20N2O — CID 91029792
2-but-1-en-2-yl-5-methyl-4-methylidene-7-methyliminohepta-2,5-dienamide (PubChem CID 91029792) has the molecular formula C14H20N2O and a molecular weight of 232.33 g/mol. Its IUPAC name is 2-but-1-en-2-yl-5-methyl-4-methylidene-7-methyliminohepta-2,5-dienamide.
| Compound Name | 2-but-1-en-2-yl-5-methyl-4-methylidene-7-methyliminohepta-2,5-dienamide |
|---|---|
| PubChem CID | 91029792 |
| Molecular Formula | C14H20N2O |
| Molecular Weight | 232.33 g/mol |
| Exact Mass | 232.16 |
| IUPAC Name | 2-but-1-en-2-yl-5-methyl-4-methylidene-7-methyliminohepta-2,5-dienamide |
| SMILES | C=C(C=C(C(=C)CC)C(N)=O)C(C)=C/C=N/C |
| InChI | InChI=1S/C14H20N2O/c1-6-10(2)13(14(15)17)9-12(4)11(3)7-8-16-5/h7-9H,2,4,6H2,1,3,5H3,(H2,15,17)/b11-7?,13-9?,16-8+ |
| InChIKey | ZNNIVAKYLHYVDH-UOOOLZFASA-N |
| XLogP | 2.57 |
| TPSA | 55.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.33 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|