C27H24FN2O+ — CID 123151129
8-[4-(2-fluorophenyl)-1-methylpyridin-1-ium-2-yl]-7-methyl-2-propan-2-yl-[1]benzofuro[2,3-b]pyridine (PubChem CID 123151129) has the molecular formula C27H24FN2O+ and a molecular weight of 411.50 g/mol. Its IUPAC name is 8-[4-(2-fluorophenyl)-1-methylpyridin-1-ium-2-yl]-7-methyl-2-propan-2-yl-[1]benzofuro[2,3-b]pyridine.
| Compound Name | 8-[4-(2-fluorophenyl)-1-methylpyridin-1-ium-2-yl]-7-methyl-2-propan-2-yl-[1]benzofuro[2,3-b]pyridine |
|---|---|
| PubChem CID | 123151129 |
| Molecular Formula | C27H24FN2O+ |
| Molecular Weight | 411.50 g/mol |
| Exact Mass | 411.19 |
| IUPAC Name | 8-[4-(2-fluorophenyl)-1-methylpyridin-1-ium-2-yl]-7-methyl-2-propan-2-yl-[1]benzofuro[2,3-b]pyridine |
| SMILES | Cc1ccc2c(oc3nc(C(C)C)ccc32)c1-c1cc(-c2ccccc2F)cc[n+]1C |
| InChI | InChI=1S/C27H24FN2O/c1-16(2)23-12-11-21-20-10-9-17(3)25(26(20)31-27(21)29-23)24-15-18(13-14-30(24)4)19-7-5-6-8-22(19)28/h5-16H,1-4H3/q+1 |
| InChIKey | XDNWWUKRVMOZDI-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 29.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.50 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|