C13H23NO — CID 123152669
2,5-dimethyl-6-(3-methylpenta-2,4-dienyl)oxan-3-amine (PubChem CID 123152669) has the molecular formula C13H23NO and a molecular weight of 209.33 g/mol. Its IUPAC name is 2,5-dimethyl-6-(3-methylpenta-2,4-dienyl)oxan-3-amine.
| Compound Name | 2,5-dimethyl-6-(3-methylpenta-2,4-dienyl)oxan-3-amine |
|---|---|
| PubChem CID | 123152669 |
| Molecular Formula | C13H23NO |
| Molecular Weight | 209.33 g/mol |
| Exact Mass | 209.18 |
| IUPAC Name | 2,5-dimethyl-6-(3-methylpenta-2,4-dienyl)oxan-3-amine |
| SMILES | C=CC(C)=CCC1OC(C)C(N)CC1C |
| InChI | InChI=1S/C13H23NO/c1-5-9(2)6-7-13-10(3)8-12(14)11(4)15-13/h5-6,10-13H,1,7-8,14H2,2-4H3 |
| InChIKey | AOPCQJRVKRSNLB-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.33 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|