C15H27N — CID 123153448
N,4-dimethyl-N-(2-methylhexa-2,4-dienyl)cyclohexan-1-amine (PubChem CID 123153448) has the molecular formula C15H27N and a molecular weight of 221.39 g/mol. Its IUPAC name is N,4-dimethyl-N-(2-methylhexa-2,4-dienyl)cyclohexan-1-amine.
| Compound Name | N,4-dimethyl-N-(2-methylhexa-2,4-dienyl)cyclohexan-1-amine |
|---|---|
| PubChem CID | 123153448 |
| Molecular Formula | C15H27N |
| Molecular Weight | 221.39 g/mol |
| Exact Mass | 221.21 |
| IUPAC Name | N,4-dimethyl-N-(2-methylhexa-2,4-dienyl)cyclohexan-1-amine |
| SMILES | CC=CC=C(C)CN(C)C1CCC(C)CC1 |
| InChI | InChI=1S/C15H27N/c1-5-6-7-14(3)12-16(4)15-10-8-13(2)9-11-15/h5-7,13,15H,8-12H2,1-4H3 |
| InChIKey | OFADNEOLDGIUIJ-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.39 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|