C19H38N2 — CID 144654671
N,4-dimethyl-N-[2-[(Z)-prop-1-enyl]iminobut-3-enyl]cyclohexan-1-amine;ethane (PubChem CID 144654671) has the molecular formula C19H38N2 and a molecular weight of 294.53 g/mol. Its IUPAC name is N,4-dimethyl-N-[2-[(Z)-prop-1-enyl]iminobut-3-enyl]cyclohexan-1-amine;ethane.
| Compound Name | N,4-dimethyl-N-[2-[(Z)-prop-1-enyl]iminobut-3-enyl]cyclohexan-1-amine;ethane |
|---|---|
| PubChem CID | 144654671 |
| Molecular Formula | C19H38N2 |
| Molecular Weight | 294.53 g/mol |
| Exact Mass | 294.30 |
| IUPAC Name | N,4-dimethyl-N-[2-[(Z)-prop-1-enyl]iminobut-3-enyl]cyclohexan-1-amine;ethane |
| SMILES | C=C/C(CN(C)C1CCC(C)CC1)=N\C=C/C.CC.CC |
| InChI | InChI=1S/C15H26N2.2C2H6/c1-5-11-16-14(6-2)12-17(4)15-9-7-13(3)8-10-15;2*1-2/h5-6,11,13,15H,2,7-10,12H2,1,3-4H3;2*1-2H3/b11-5-,16-14+;; |
| InChIKey | RTEHZLGHHQJFRW-WJPLZXOPSA-N |
| XLogP | 5.71 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.53 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|