C13H20F2O3 — CID 123154155
methyl 2-(5,5-difluoro-2-hydroxy-1,3,3a,4,6,6a-hexahydropentalen-2-yl)-2-methylpropanoate (PubChem CID 123154155) has the molecular formula C13H20F2O3 and a molecular weight of 262.30 g/mol. Its IUPAC name is methyl 2-(5,5-difluoro-2-hydroxy-1,3,3a,4,6,6a-hexahydropentalen-2-yl)-2-methylpropanoate.
| Compound Name | methyl 2-(5,5-difluoro-2-hydroxy-1,3,3a,4,6,6a-hexahydropentalen-2-yl)-2-methylpropanoate |
|---|---|
| PubChem CID | 123154155 |
| Molecular Formula | C13H20F2O3 |
| Molecular Weight | 262.30 g/mol |
| Exact Mass | 262.14 |
| IUPAC Name | methyl 2-(5,5-difluoro-2-hydroxy-1,3,3a,4,6,6a-hexahydropentalen-2-yl)-2-methylpropanoate |
| SMILES | COC(=O)C(C)(C)C1(O)CC2CC(F)(F)CC2C1 |
| InChI | InChI=1S/C13H20F2O3/c1-11(2,10(16)18-3)12(17)4-8-6-13(14,15)7-9(8)5-12/h8-9,17H,4-7H2,1-3H3 |
| InChIKey | LDZOGGYEOAWCQO-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.30 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |