C12H20O3 — CID 15807768
ethyl (1R,3aR,6aS)-6a-hydroxy-1-methyl-1,2,3,4,5,6-hexahydropentalene-3a-carboxylate (PubChem CID 15807768) has the molecular formula C12H20O3 and a molecular weight of 212.29 g/mol. Its IUPAC name is ethyl (1R,3aR,6aS)-6a-hydroxy-1-methyl-1,2,3,4,5,6-hexahydropentalene-3a-carboxylate.
| Compound Name | ethyl (1R,3aR,6aS)-6a-hydroxy-1-methyl-1,2,3,4,5,6-hexahydropentalene-3a-carboxylate |
|---|---|
| PubChem CID | 15807768 |
| Molecular Formula | C12H20O3 |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.14 |
| IUPAC Name | ethyl (1R,3aR,6aS)-6a-hydroxy-1-methyl-1,2,3,4,5,6-hexahydropentalene-3a-carboxylate |
| SMILES | CCOC(=O)[C@@]12CCC[C@]1(O)[C@H](C)CC2 |
| InChI | InChI=1S/C12H20O3/c1-3-15-10(13)11-6-4-7-12(11,14)9(2)5-8-11/h9,14H,3-8H2,1-2H3/t9-,11+,12+/m1/s1 |
| InChIKey | NESDTXWZQJXTKC-USWWRNFRSA-N |
| XLogP | 1.88 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |