C18H29N — CID 123155194
[4-(4,8-dimethylnona-3,7-dienyl)cyclohex-3-en-1-yl]methanimine (PubChem CID 123155194) has the molecular formula C18H29N and a molecular weight of 259.44 g/mol. Its IUPAC name is [4-(4,8-dimethylnona-3,7-dienyl)cyclohex-3-en-1-yl]methanimine.
| Compound Name | [4-(4,8-dimethylnona-3,7-dienyl)cyclohex-3-en-1-yl]methanimine |
|---|---|
| PubChem CID | 123155194 |
| Molecular Formula | C18H29N |
| Molecular Weight | 259.44 g/mol |
| Exact Mass | 259.23 |
| IUPAC Name | [4-(4,8-dimethylnona-3,7-dienyl)cyclohex-3-en-1-yl]methanimine |
| SMILES | [H]/N=C/C1CC=C(CCC=C(C)CCC=C(C)C)CC1 |
| InChI | InChI=1S/C18H29N/c1-15(2)6-4-7-16(3)8-5-9-17-10-12-18(14-19)13-11-17/h6,8,10,14,18-19H,4-5,7,9,11-13H2,1-3H3/b16-8?,19-14+ |
| InChIKey | MQRZFQHVPADIKY-OQYBPCDGSA-N |
| XLogP | 5.84 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.44 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|