C28H28ClN3O — CID 123156202
2-[4-[4-[5-(4-chloro-6-ethyl-1H-benzimidazol-2-yl)-2-pyridinyl]phenyl]cyclohexyl]acetaldehyde (PubChem CID 123156202) has the molecular formula C28H28ClN3O and a molecular weight of 458.01 g/mol. Its IUPAC name is 2-[4-[4-[5-(4-chloro-6-ethyl-1H-benzimidazol-2-yl)-2-pyridinyl]phenyl]cyclohexyl]acetaldehyde.
| Compound Name | 2-[4-[4-[5-(4-chloro-6-ethyl-1H-benzimidazol-2-yl)-2-pyridinyl]phenyl]cyclohexyl]acetaldehyde |
|---|---|
| PubChem CID | 123156202 |
| Molecular Formula | C28H28ClN3O |
| Molecular Weight | 458.01 g/mol |
| Exact Mass | 457.19 |
| IUPAC Name | 2-[4-[4-[5-(4-chloro-6-ethyl-1H-benzimidazol-2-yl)-2-pyridinyl]phenyl]cyclohexyl]acetaldehyde |
| SMILES | CCc1cc(Cl)c2nc(-c3ccc(-c4ccc(C5CCC(CC=O)CC5)cc4)nc3)[nH]c2c1 |
| InChI | InChI=1S/C28H28ClN3O/c1-2-18-15-24(29)27-26(16-18)31-28(32-27)23-11-12-25(30-17-23)22-9-7-21(8-10-22)20-5-3-19(4-6-20)13-14-33/h7-12,14-17,19-20H,2-6,13H2,1H3,(H,31,32) |
| InChIKey | SJMAEAWOOQMWGT-UHFFFAOYSA-N |
| XLogP | 7.37 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.01 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|