C21H27N — CID 3126265
5-ethyl-2-[4-(4-ethylcyclohexyl)phenyl]pyridine (PubChem CID 3126265) has the molecular formula C21H27N and a molecular weight of 293.45 g/mol. Its IUPAC name is 5-ethyl-2-[4-(4-ethylcyclohexyl)phenyl]pyridine.
| Compound Name | 5-ethyl-2-[4-(4-ethylcyclohexyl)phenyl]pyridine |
|---|---|
| PubChem CID | 3126265 |
| Molecular Formula | C21H27N |
| Molecular Weight | 293.45 g/mol |
| Exact Mass | 293.21 |
| IUPAC Name | 5-ethyl-2-[4-(4-ethylcyclohexyl)phenyl]pyridine |
| SMILES | CCc1ccc(-c2ccc(C3CCC(CC)CC3)cc2)nc1 |
| InChI | InChI=1S/C21H27N/c1-3-16-5-8-18(9-6-16)19-10-12-20(13-11-19)21-14-7-17(4-2)15-22-21/h7,10-16,18H,3-6,8-9H2,1-2H3 |
| InChIKey | GXVLUZKLUFKTKI-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.45 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |