C23H31N — CID 7283254
5-ethyl-2-[4-[(1R,3R,4R)-3-methyl-4-propylcyclohexyl]phenyl]pyridine (PubChem CID 7283254) has the molecular formula C23H31N and a molecular weight of 321.51 g/mol. Its IUPAC name is 5-ethyl-2-[4-[(1R,3R,4R)-3-methyl-4-propylcyclohexyl]phenyl]pyridine.
| Compound Name | 5-ethyl-2-[4-[(1R,3R,4R)-3-methyl-4-propylcyclohexyl]phenyl]pyridine |
|---|---|
| PubChem CID | 7283254 |
| Molecular Formula | C23H31N |
| Molecular Weight | 321.51 g/mol |
| Exact Mass | 321.25 |
| IUPAC Name | 5-ethyl-2-[4-[(1R,3R,4R)-3-methyl-4-propylcyclohexyl]phenyl]pyridine |
| SMILES | CCC[C@@H]1CC[C@@H](c2ccc(-c3ccc(CC)cn3)cc2)C[C@H]1C |
| InChI | InChI=1S/C23H31N/c1-4-6-19-8-13-22(15-17(19)3)20-9-11-21(12-10-20)23-14-7-18(5-2)16-24-23/h7,9-12,14,16-17,19,22H,4-6,8,13,15H2,1-3H3/t17-,19-,22-/m1/s1 |
| InChIKey | PTYQVHLQFUQIHE-SFGWALBWSA-N |
| XLogP | 6.63 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.51 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |