C26H33NO2 — CID 67643802
2-[4-[4-(5-pentyl-2-pyridinyl)phenyl]cyclohexyl]but-2-enoic acid (PubChem CID 67643802) has the molecular formula C26H33NO2 and a molecular weight of 391.56 g/mol. Its IUPAC name is 2-[4-[4-(5-pentyl-2-pyridinyl)phenyl]cyclohexyl]but-2-enoic acid.
| Compound Name | 2-[4-[4-(5-pentyl-2-pyridinyl)phenyl]cyclohexyl]but-2-enoic acid |
|---|---|
| PubChem CID | 67643802 |
| Molecular Formula | C26H33NO2 |
| Molecular Weight | 391.56 g/mol |
| Exact Mass | 391.25 |
| IUPAC Name | 2-[4-[4-(5-pentyl-2-pyridinyl)phenyl]cyclohexyl]but-2-enoic acid |
| SMILES | CC=C(C(=O)O)C1CCC(c2ccc(-c3ccc(CCCCC)cn3)cc2)CC1 |
| InChI | InChI=1S/C26H33NO2/c1-3-5-6-7-19-8-17-25(27-18-19)23-15-11-21(12-16-23)20-9-13-22(14-10-20)24(4-2)26(28)29/h4,8,11-12,15-18,20,22H,3,5-7,9-10,13-14H2,1-2H3,(H,28,29) |
| InChIKey | DOSNBXCKYXKOHT-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.56 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|