C17H16Cl2N2O2 — CID 123157205
2-amino-5-chloro-3-(2-chloro-4-propoxyphenyl)indol-3-ol (PubChem CID 123157205) has the molecular formula C17H16Cl2N2O2 and a molecular weight of 351.23 g/mol. Its IUPAC name is 2-amino-5-chloro-3-(2-chloro-4-propoxyphenyl)indol-3-ol.
| Compound Name | 2-amino-5-chloro-3-(2-chloro-4-propoxyphenyl)indol-3-ol |
|---|---|
| PubChem CID | 123157205 |
| Molecular Formula | C17H16Cl2N2O2 |
| Molecular Weight | 351.23 g/mol |
| Exact Mass | 350.06 |
| IUPAC Name | 2-amino-5-chloro-3-(2-chloro-4-propoxyphenyl)indol-3-ol |
| SMILES | CCCOc1ccc(C2(O)C(N)=Nc3ccc(Cl)cc32)c(Cl)c1 |
| InChI | InChI=1S/C17H16Cl2N2O2/c1-2-7-23-11-4-5-12(14(19)9-11)17(22)13-8-10(18)3-6-15(13)21-16(17)20/h3-6,8-9,22H,2,7H2,1H3,(H2,20,21) |
| InChIKey | YHUIFJYNUCYTBR-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 67.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.23 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |