About 2-fluoroethyl 3-(6-methylidene-3-bicyclo[3.2.1]octanyl)propanoate
2-fluoroethyl 3-(6-methylidene-3-bicyclo[3.2.1]octanyl)propanoate (PubChem CID 123158155) has the molecular formula C14H21FO2
and a molecular weight of 240.32 g/mol. Its IUPAC name is 2-fluoroethyl 3-(6-methylidene-3-bicyclo[3.2.1]octanyl)propanoate.
Molecular Properties
| Compound Name | 2-fluoroethyl 3-(6-methylidene-3-bicyclo[3.2.1]octanyl)propanoate |
| PubChem CID | 123158155 |
| Molecular Formula | C14H21FO2 |
| Molecular Weight | 240.32 g/mol |
| Exact Mass | 240.15 |
| IUPAC Name | 2-fluoroethyl 3-(6-methylidene-3-bicyclo[3.2.1]octanyl)propanoate |
| SMILES | C=C1CC2CC(CCC(=O)OCCF)CC1C2 |
| InChI | InChI=1S/C14H21FO2/c1-10-6-12-7-11(8-13(10)9-12)2-3-14(16)17-5-4-15/h11-13H,1-9H2 |
| InChIKey | HBUVTWCSWRZXCB-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.32 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-fluoroethyl 3-(6-methylidene-3-bicyclo[3.2.1]octanyl)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoroethyl 3-(6-methylidene-3-bicyclo[3.2.1]octanyl)propanoate?
The IUPAC name of 2-fluoroethyl 3-(6-methylidene-3-bicyclo[3.2.1]octanyl)propanoate (CID 123158155) is 2-fluoroethyl 3-(6-methylidene-3-bicyclo[3.2.1]octanyl)propanoate.
What is the SMILES notation for 2-fluoroethyl 3-(6-methylidene-3-bicyclo[3.2.1]octanyl)propanoate?
The canonical SMILES for 2-fluoroethyl 3-(6-methylidene-3-bicyclo[3.2.1]octanyl)propanoate is C=C1CC2CC(CCC(=O)OCCF)CC1C2.
What is the InChIKey of 2-fluoroethyl 3-(6-methylidene-3-bicyclo[3.2.1]octanyl)propanoate?
The InChIKey is HBUVTWCSWRZXCB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21FO2/c1-10-6-12-7-11(8-13(10)9-12)2-3-14(16)17-5-4-15/h11-13H,1-9H2.
What are the key properties of 2-fluoroethyl 3-(6-methylidene-3-bicyclo[3.2.1]octanyl)propanoate?
2-fluoroethyl 3-(6-methylidene-3-bicyclo[3.2.1]octanyl)propanoate has a molecular weight of 240.32 g/mol, XLogP of 3.27, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoroethyl 3-(6-methylidene-3-bicyclo[3.2.1]octanyl)propanoate is sourced from PubChem (CID 123158155), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).