C15H19F5O2 — CID 178021561
2,2,2-trifluoroethyl 2-(4,4-difluorocyclohexyl)-4-methylidenecyclopentane-1-carboxylate (PubChem CID 178021561) has the molecular formula C15H19F5O2 and a molecular weight of 326.31 g/mol. Its IUPAC name is 2,2,2-trifluoroethyl 2-(4,4-difluorocyclohexyl)-4-methylidenecyclopentane-1-carboxylate.
| Compound Name | 2,2,2-trifluoroethyl 2-(4,4-difluorocyclohexyl)-4-methylidenecyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 178021561 |
| Molecular Formula | C15H19F5O2 |
| Molecular Weight | 326.31 g/mol |
| Exact Mass | 326.13 |
| IUPAC Name | 2,2,2-trifluoroethyl 2-(4,4-difluorocyclohexyl)-4-methylidenecyclopentane-1-carboxylate |
| SMILES | C=C1CC(C(=O)OCC(F)(F)F)C(C2CCC(F)(F)CC2)C1 |
| InChI | InChI=1S/C15H19F5O2/c1-9-6-11(10-2-4-14(16,17)5-3-10)12(7-9)13(21)22-8-15(18,19)20/h10-12H,1-8H2 |
| InChIKey | QORLEZPYPGZUIB-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.31 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|