C14H21F3O2 — CID 123375759
ethyl 3-ethyl-4-methylidene-1-(2,2,2-trifluoroethyl)cyclohexane-1-carboxylate (PubChem CID 123375759) has the molecular formula C14H21F3O2 and a molecular weight of 278.31 g/mol. Its IUPAC name is ethyl 3-ethyl-4-methylidene-1-(2,2,2-trifluoroethyl)cyclohexane-1-carboxylate.
| Compound Name | ethyl 3-ethyl-4-methylidene-1-(2,2,2-trifluoroethyl)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 123375759 |
| Molecular Formula | C14H21F3O2 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | ethyl 3-ethyl-4-methylidene-1-(2,2,2-trifluoroethyl)cyclohexane-1-carboxylate |
| SMILES | C=C1CCC(CC(F)(F)F)(C(=O)OCC)CC1CC |
| InChI | InChI=1S/C14H21F3O2/c1-4-11-8-13(7-6-10(11)3,9-14(15,16)17)12(18)19-5-2/h11H,3-9H2,1-2H3 |
| InChIKey | YEGWJSUWJQVXGX-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|