C19H27F5O2 — CID 151649740
2,2,3,3,3-pentafluoropropyl 9-(2-bicyclo[2.2.1]hept-5-enyl)nonanoate (PubChem CID 151649740) has the molecular formula C19H27F5O2 and a molecular weight of 382.41 g/mol. Its IUPAC name is 2,2,3,3,3-pentafluoropropyl 9-(2-bicyclo[2.2.1]hept-5-enyl)nonanoate.
| Compound Name | 2,2,3,3,3-pentafluoropropyl 9-(2-bicyclo[2.2.1]hept-5-enyl)nonanoate |
|---|---|
| PubChem CID | 151649740 |
| Molecular Formula | C19H27F5O2 |
| Molecular Weight | 382.41 g/mol |
| Exact Mass | 382.19 |
| IUPAC Name | 2,2,3,3,3-pentafluoropropyl 9-(2-bicyclo[2.2.1]hept-5-enyl)nonanoate |
| SMILES | O=C(CCCCCCCCC1CC2C=CC1C2)OCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C19H27F5O2/c20-18(21,19(22,23)24)13-26-17(25)8-6-4-2-1-3-5-7-15-11-14-9-10-16(15)12-14/h9-10,14-16H,1-8,11-13H2 |
| InChIKey | QUGPAQSAAKKVNC-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.41 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|