C22H22N4O2S2 — CID 123158450
1-(4-methylphenyl)-3-[2-[(4-methylphenyl)sulfanylcarbamoylamino]phenyl]sulfanylurea (PubChem CID 123158450) has the molecular formula C22H22N4O2S2 and a molecular weight of 438.58 g/mol. Its IUPAC name is 1-(4-methylphenyl)-3-[2-[(4-methylphenyl)sulfanylcarbamoylamino]phenyl]sulfanylurea.
| Compound Name | 1-(4-methylphenyl)-3-[2-[(4-methylphenyl)sulfanylcarbamoylamino]phenyl]sulfanylurea |
|---|---|
| PubChem CID | 123158450 |
| Molecular Formula | C22H22N4O2S2 |
| Molecular Weight | 438.58 g/mol |
| Exact Mass | 438.12 |
| IUPAC Name | 1-(4-methylphenyl)-3-[2-[(4-methylphenyl)sulfanylcarbamoylamino]phenyl]sulfanylurea |
| SMILES | Cc1ccc(NC(=O)NSc2ccccc2NC(=O)NSc2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C22H22N4O2S2/c1-15-7-11-17(12-8-15)23-21(27)26-30-20-6-4-3-5-19(20)24-22(28)25-29-18-13-9-16(2)10-14-18/h3-14H,1-2H3,(H2,23,26,27)(H2,24,25,28) |
| InChIKey | GXDFBPHFDLXOBL-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 82.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.58 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|