C48H67N4+ — CID 123159209
1-(2,4,6-tritert-butylphenyl)-2-[3-[3-(2,4,6-tritert-butylphenyl)-1H-imidazol-3-ium-2-yl]phenyl]imidazole (PubChem CID 123159209) has the molecular formula C48H67N4+ and a molecular weight of 700.09 g/mol. Its IUPAC name is 1-(2,4,6-tritert-butylphenyl)-2-[3-[3-(2,4,6-tritert-butylphenyl)-1H-imidazol-3-ium-2-yl]phenyl]imidazole.
| Compound Name | 1-(2,4,6-tritert-butylphenyl)-2-[3-[3-(2,4,6-tritert-butylphenyl)-1H-imidazol-3-ium-2-yl]phenyl]imidazole |
|---|---|
| PubChem CID | 123159209 |
| Molecular Formula | C48H67N4+ |
| Molecular Weight | 700.09 g/mol |
| Exact Mass | 699.54 |
| IUPAC Name | 1-(2,4,6-tritert-butylphenyl)-2-[3-[3-(2,4,6-tritert-butylphenyl)-1H-imidazol-3-ium-2-yl]phenyl]imidazole |
| SMILES | CC(C)(C)c1cc(C(C)(C)C)c(-n2ccnc2-c2cccc(-c3[nH]cc[n+]3-c3c(C(C)(C)C)cc(C(C)(C)C)cc3C(C)(C)C)c2)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C48H66N4/c1-43(2,3)33-27-35(45(7,8)9)39(36(28-33)46(10,11)12)51-24-22-49-41(51)31-20-19-21-32(26-31)42-50-23-25-52(42)40-37(47(13,14)15)29-34(44(4,5)6)30-38(40)48(16,17)18/h19-30H,1-18H3/p+1 |
| InChIKey | SDIZEUJOMZPJBD-UHFFFAOYSA-O |
| XLogP | 12.60 |
| TPSA | 37.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.09 |
| LogP ≤ 5 | 12.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|