C24H30N2 — CID 140703322
1-(2,6-ditert-butyl-4-methylphenyl)-2-phenylimidazole (PubChem CID 140703322) has the molecular formula C24H30N2 and a molecular weight of 346.52 g/mol. Its IUPAC name is 1-(2,6-ditert-butyl-4-methylphenyl)-2-phenylimidazole.
| Compound Name | 1-(2,6-ditert-butyl-4-methylphenyl)-2-phenylimidazole |
|---|---|
| PubChem CID | 140703322 |
| Molecular Formula | C24H30N2 |
| Molecular Weight | 346.52 g/mol |
| Exact Mass | 346.24 |
| IUPAC Name | 1-(2,6-ditert-butyl-4-methylphenyl)-2-phenylimidazole |
| SMILES | Cc1cc(C(C)(C)C)c(-n2ccnc2-c2ccccc2)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C24H30N2/c1-17-15-19(23(2,3)4)21(20(16-17)24(5,6)7)26-14-13-25-22(26)18-11-9-8-10-12-18/h8-16H,1-7H3 |
| InChIKey | SXIFUPFDGFOKCX-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.52 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |