C24H11F7N4 — CID 123159430
5-[4-(1,2-difluorobuta-1,3-dienyl)-2,6-difluorophenyl]-2-[2-(3,4,5-trifluorophenyl)pyrimidin-5-yl]pyrimidine (PubChem CID 123159430) has the molecular formula C24H11F7N4 and a molecular weight of 488.37 g/mol. Its IUPAC name is 5-[4-(1,2-difluorobuta-1,3-dienyl)-2,6-difluorophenyl]-2-[2-(3,4,5-trifluorophenyl)pyrimidin-5-yl]pyrimidine.
| Compound Name | 5-[4-(1,2-difluorobuta-1,3-dienyl)-2,6-difluorophenyl]-2-[2-(3,4,5-trifluorophenyl)pyrimidin-5-yl]pyrimidine |
|---|---|
| PubChem CID | 123159430 |
| Molecular Formula | C24H11F7N4 |
| Molecular Weight | 488.37 g/mol |
| Exact Mass | 488.09 |
| IUPAC Name | 5-[4-(1,2-difluorobuta-1,3-dienyl)-2,6-difluorophenyl]-2-[2-(3,4,5-trifluorophenyl)pyrimidin-5-yl]pyrimidine |
| SMILES | C=CC(F)=C(F)c1cc(F)c(-c2cnc(-c3cnc(-c4cc(F)c(F)c(F)c4)nc3)nc2)c(F)c1 |
| InChI | InChI=1S/C24H11F7N4/c1-2-15(25)21(30)11-3-16(26)20(17(27)4-11)13-7-32-24(33-8-13)14-9-34-23(35-10-14)12-5-18(28)22(31)19(29)6-12/h2-10H,1H2 |
| InChIKey | RHNNYIOIIQXURA-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.37 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|