C21H24N2O3 — CID 123159516
2-butyl-4-hydroxy-1-(3-phenylmethoxyphenyl)-4,6-dihydropyrimidin-5-one (PubChem CID 123159516) has the molecular formula C21H24N2O3 and a molecular weight of 352.43 g/mol. Its IUPAC name is 2-butyl-4-hydroxy-1-(3-phenylmethoxyphenyl)-4,6-dihydropyrimidin-5-one.
| Compound Name | 2-butyl-4-hydroxy-1-(3-phenylmethoxyphenyl)-4,6-dihydropyrimidin-5-one |
|---|---|
| PubChem CID | 123159516 |
| Molecular Formula | C21H24N2O3 |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.18 |
| IUPAC Name | 2-butyl-4-hydroxy-1-(3-phenylmethoxyphenyl)-4,6-dihydropyrimidin-5-one |
| SMILES | CCCCC1=NC(O)C(=O)CN1c1cccc(OCc2ccccc2)c1 |
| InChI | InChI=1S/C21H24N2O3/c1-2-3-12-20-22-21(25)19(24)14-23(20)17-10-7-11-18(13-17)26-15-16-8-5-4-6-9-16/h4-11,13,21,25H,2-3,12,14-15H2,1H3 |
| InChIKey | UAYLKYKQHAWHQS-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 62.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |