C10H16O2 — CID 123159733
5-methoxynona-3,5-dienal (PubChem CID 123159733) has the molecular formula C10H16O2 and a molecular weight of 168.24 g/mol. Its IUPAC name is 5-methoxynona-3,5-dienal.
| Compound Name | 5-methoxynona-3,5-dienal |
|---|---|
| PubChem CID | 123159733 |
| Molecular Formula | C10H16O2 |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.12 |
| IUPAC Name | 5-methoxynona-3,5-dienal |
| SMILES | CCCC=C(C=CCC=O)OC |
| InChI | InChI=1S/C10H16O2/c1-3-4-7-10(12-2)8-5-6-9-11/h5,7-9H,3-4,6H2,1-2H3 |
| InChIKey | OUDZQFQNYJDTPK-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|