C6H10N2 — CID 123159948
2-ethylidenebutane-1,3-diimine (PubChem CID 123159948) has the molecular formula C6H10N2 and a molecular weight of 110.16 g/mol. Its IUPAC name is 2-ethylidenebutane-1,3-diimine.
| Compound Name | 2-ethylidenebutane-1,3-diimine |
|---|---|
| PubChem CID | 123159948 |
| Molecular Formula | C6H10N2 |
| Molecular Weight | 110.16 g/mol |
| Exact Mass | 110.08 |
| IUPAC Name | 2-ethylidenebutane-1,3-diimine |
| SMILES | [H]/N=C/C(=CC)/C(C)=N/[H] |
| InChI | InChI=1S/C6H10N2/c1-3-6(4-7)5(2)8/h3-4,7-8H,1-2H3/b6-3?,7-4+,8-5+ |
| InChIKey | IIUCQGWETXCWNB-ONGMCEHOSA-N |
| XLogP | 1.62 |
| TPSA | 47.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 110.16 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|