C7H11FN2 — CID 123164030
5-fluoro-5-methylhex-2-ene-1,4-diimine (PubChem CID 123164030) has the molecular formula C7H11FN2 and a molecular weight of 142.18 g/mol. Its IUPAC name is 5-fluoro-5-methylhex-2-ene-1,4-diimine.
| Compound Name | 5-fluoro-5-methylhex-2-ene-1,4-diimine |
|---|---|
| PubChem CID | 123164030 |
| Molecular Formula | C7H11FN2 |
| Molecular Weight | 142.18 g/mol |
| Exact Mass | 142.09 |
| IUPAC Name | 5-fluoro-5-methylhex-2-ene-1,4-diimine |
| SMILES | [H]/N=C/C=C/C(=N\[H])C(C)(C)F |
| InChI | InChI=1S/C7H11FN2/c1-7(2,8)6(10)4-3-5-9/h3-5,9-10H,1-2H3/b4-3?,9-5+,10-6+ |
| InChIKey | VLSZDIIDKATEFK-LVYVESJWSA-N |
| XLogP | 1.96 |
| TPSA | 47.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.18 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|