C10H15FN2 — CID 123282351
4-ethyl-5-fluoroocta-4,6-diene-1,3-diimine (PubChem CID 123282351) has the molecular formula C10H15FN2 and a molecular weight of 182.24 g/mol. Its IUPAC name is 4-ethyl-5-fluoroocta-4,6-diene-1,3-diimine.
| Compound Name | 4-ethyl-5-fluoroocta-4,6-diene-1,3-diimine |
|---|---|
| PubChem CID | 123282351 |
| Molecular Formula | C10H15FN2 |
| Molecular Weight | 182.24 g/mol |
| Exact Mass | 182.12 |
| IUPAC Name | 4-ethyl-5-fluoroocta-4,6-diene-1,3-diimine |
| SMILES | [H]/N=C/C/C(=N\[H])C(CC)=C(F)C=CC |
| InChI | InChI=1S/C10H15FN2/c1-3-5-9(11)8(4-2)10(13)6-7-12/h3,5,7,12-13H,4,6H2,1-2H3/b5-3?,9-8?,12-7+,13-10+ |
| InChIKey | JAIPMFJVWYSIBO-DTQULKCNSA-N |
| XLogP | 3.26 |
| TPSA | 47.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.24 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|