C7H12N2 — CID 123802177
(Z)-hept-5-ene-3,4-diimine (PubChem CID 123802177) has the molecular formula C7H12N2 and a molecular weight of 124.19 g/mol. Its IUPAC name is (Z)-hept-5-ene-3,4-diimine.
| Compound Name | (Z)-hept-5-ene-3,4-diimine |
|---|---|
| PubChem CID | 123802177 |
| Molecular Formula | C7H12N2 |
| Molecular Weight | 124.19 g/mol |
| Exact Mass | 124.10 |
| IUPAC Name | (Z)-hept-5-ene-3,4-diimine |
| SMILES | [H]/N=C(/C=C\C)C(\CC)=N\[H] |
| InChI | InChI=1S/C7H12N2/c1-3-5-7(9)6(8)4-2/h3,5,8-9H,4H2,1-2H3/b5-3-,8-6+,9-7- |
| InChIKey | HWSWBSSDZLJGCT-UBPHEOMNSA-N |
| XLogP | 2.01 |
| TPSA | 47.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 124.19 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|