C9H16N2 — CID 90709896
(Z)-3-methyloct-5-ene-1,7-diimine (PubChem CID 90709896) has the molecular formula C9H16N2 and a molecular weight of 152.24 g/mol. Its IUPAC name is (Z)-3-methyloct-5-ene-1,7-diimine.
| Compound Name | (Z)-3-methyloct-5-ene-1,7-diimine |
|---|---|
| PubChem CID | 90709896 |
| Molecular Formula | C9H16N2 |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.13 |
| IUPAC Name | (Z)-3-methyloct-5-ene-1,7-diimine |
| SMILES | [H]/N=C/CC(C)C/C=C\C(C)=N\[H] |
| InChI | InChI=1S/C9H16N2/c1-8(6-7-10)4-3-5-9(2)11/h3,5,7-8,10-11H,4,6H2,1-2H3/b5-3-,10-7+,11-9+ |
| InChIKey | PBZVTHQSWODZMQ-CDLXSBAISA-N |
| XLogP | 2.65 |
| TPSA | 47.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|