C30H51N9O6 — CID 123159996
4-[[12-butan-2-yl-3-[2-(methylamino)propanoylamino]-10,13-dioxo-5,11,14,20,21,22-hexazatricyclo[18.2.1.05,9]tricosa-1(23),21-diene-15-carbonyl]amino]butanoic acid (PubChem CID 123159996) has the molecular formula C30H51N9O6 and a molecular weight of 633.80 g/mol. Its IUPAC name is 4-[[12-butan-2-yl-3-[2-(methylamino)propanoylamino]-10,13-dioxo-5,11,14,20,21,22-hexazatricyclo[18.2.1.05,9]tricosa-1(23),21-diene-15-carbonyl]amino]butanoic acid.
| Compound Name | 4-[[12-butan-2-yl-3-[2-(methylamino)propanoylamino]-10,13-dioxo-5,11,14,20,21,22-hexazatricyclo[18.2.1.05,9]tricosa-1(23),21-diene-15-carbonyl]amino]butanoic acid |
|---|---|
| PubChem CID | 123159996 |
| Molecular Formula | C30H51N9O6 |
| Molecular Weight | 633.80 g/mol |
| Exact Mass | 633.40 |
| IUPAC Name | 4-[[12-butan-2-yl-3-[2-(methylamino)propanoylamino]-10,13-dioxo-5,11,14,20,21,22-hexazatricyclo[18.2.1.05,9]tricosa-1(23),21-diene-15-carbonyl]amino]butanoic acid |
| SMILES | CCC(C)C1NC(=O)C2CCCN2CC(NC(=O)C(C)NC)Cc2cn(nn2)CCCCC(C(=O)NCCCC(=O)O)NC1=O |
| InChI | InChI=1S/C30H51N9O6/c1-5-19(2)26-30(45)34-23(28(43)32-13-8-12-25(40)41)10-6-7-15-39-18-22(36-37-39)16-21(33-27(42)20(3)31-4)17-38-14-9-11-24(38)29(44)35-26/h18-21,23-24,26,31H,5-17H2,1-4H3,(H,32,43)(H,33,42)(H,34,45)(H,35,44)(H,40,41) |
| InChIKey | PTWNFCIRFZRDIX-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 199.68 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.80 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|