C12H20N+ — CID 123162897
1,1-dimethyl-3-pent-1-enyl-2H-pyridin-1-ium (PubChem CID 123162897) has the molecular formula C12H20N+ and a molecular weight of 178.30 g/mol. Its IUPAC name is 1,1-dimethyl-3-pent-1-enyl-2H-pyridin-1-ium.
| Compound Name | 1,1-dimethyl-3-pent-1-enyl-2H-pyridin-1-ium |
|---|---|
| PubChem CID | 123162897 |
| Molecular Formula | C12H20N+ |
| Molecular Weight | 178.30 g/mol |
| Exact Mass | 178.16 |
| IUPAC Name | 1,1-dimethyl-3-pent-1-enyl-2H-pyridin-1-ium |
| SMILES | CCCC=CC1=CC=C[N+](C)(C)C1 |
| InChI | InChI=1S/C12H20N/c1-4-5-6-8-12-9-7-10-13(2,3)11-12/h6-10H,4-5,11H2,1-3H3/q+1 |
| InChIKey | VLSSHDJEDHMJSQ-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.30 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|