C49H87NO4Si2 — CID 123163546
N-[(2S,3S,4S)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-1-hydroxy-11-phenylundecan-2-yl]icosa-5,8,11,14-tetraenamide (PubChem CID 123163546) has the molecular formula C49H87NO4Si2 and a molecular weight of 810.41 g/mol. Its IUPAC name is N-[(2S,3S,4S)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-1-hydroxy-11-phenylundecan-2-yl]icosa-5,8,11,14-tetraenamide.
| Compound Name | N-[(2S,3S,4S)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-1-hydroxy-11-phenylundecan-2-yl]icosa-5,8,11,14-tetraenamide |
|---|---|
| PubChem CID | 123163546 |
| Molecular Formula | C49H87NO4Si2 |
| Molecular Weight | 810.41 g/mol |
| Exact Mass | 809.62 |
| IUPAC Name | N-[(2S,3S,4S)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-1-hydroxy-11-phenylundecan-2-yl]icosa-5,8,11,14-tetraenamide |
| SMILES | CCCCCC=CCC=CCC=CCC=CCCCC(=O)N[C@@H](CO)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](CCCCCCCc1ccccc1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C49H87NO4Si2/c1-12-13-14-15-16-17-18-19-20-21-22-23-24-25-26-30-36-41-46(52)50-44(42-51)47(54-56(10,11)49(5,6)7)45(53-55(8,9)48(2,3)4)40-35-29-27-28-32-37-43-38-33-31-34-39-43/h16-17,19-20,22-23,25-26,31,33-34,38-39,44-45,47,51H,12-15,18,21,24,27-30,32,35-37,40-42H2,1-11H3,(H,50,52)/t44-,45-,47-/m0/s1 |
| InChIKey | NJHZBXAEXIYYNI-ZNSIVILSSA-N |
| XLogP | 13.97 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 810.41 |
| LogP ≤ 5 | 13.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|