C29H43NO2 — CID 44563679
(5Z,8Z,11Z,14Z)-N-[(2R)-1-hydroxypropan-2-yl]-20-phenylicosa-5,8,11,14-tetraenamide (PubChem CID 44563679) has the molecular formula C29H43NO2 and a molecular weight of 437.67 g/mol. Its IUPAC name is (5Z,8Z,11Z,14Z)-N-[(2R)-1-hydroxypropan-2-yl]-20-phenylicosa-5,8,11,14-tetraenamide.
| Compound Name | (5Z,8Z,11Z,14Z)-N-[(2R)-1-hydroxypropan-2-yl]-20-phenylicosa-5,8,11,14-tetraenamide |
|---|---|
| PubChem CID | 44563679 |
| Molecular Formula | C29H43NO2 |
| Molecular Weight | 437.67 g/mol |
| Exact Mass | 437.33 |
| IUPAC Name | (5Z,8Z,11Z,14Z)-N-[(2R)-1-hydroxypropan-2-yl]-20-phenylicosa-5,8,11,14-tetraenamide |
| SMILES | C[C@H](CO)NC(=O)CCC/C=C\C/C=C\C/C=C\C/C=C\CCCCCc1ccccc1 |
| InChI | InChI=1S/C29H43NO2/c1-27(26-31)30-29(32)25-21-16-14-12-10-8-6-4-2-3-5-7-9-11-13-15-18-22-28-23-19-17-20-24-28/h2-3,6-9,12,14,17,19-20,23-24,27,31H,4-5,10-11,13,15-16,18,21-22,25-26H2,1H3,(H,30,32)/b3-2-,8-6-,9-7-,14-12-/t27-/m1/s1 |
| InChIKey | DFLULNJNYNQBPP-YGMZKKJISA-N |
| XLogP | 6.85 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.67 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|