C25H35NO2 — CID 44563658
(5Z,8Z,11Z,14Z)-N-[(2R)-1-hydroxypropan-2-yl]-16-phenylhexadeca-5,8,11,14-tetraenamide (PubChem CID 44563658) has the molecular formula C25H35NO2 and a molecular weight of 381.56 g/mol. Its IUPAC name is (5Z,8Z,11Z,14Z)-N-[(2R)-1-hydroxypropan-2-yl]-16-phenylhexadeca-5,8,11,14-tetraenamide.
| Compound Name | (5Z,8Z,11Z,14Z)-N-[(2R)-1-hydroxypropan-2-yl]-16-phenylhexadeca-5,8,11,14-tetraenamide |
|---|---|
| PubChem CID | 44563658 |
| Molecular Formula | C25H35NO2 |
| Molecular Weight | 381.56 g/mol |
| Exact Mass | 381.27 |
| IUPAC Name | (5Z,8Z,11Z,14Z)-N-[(2R)-1-hydroxypropan-2-yl]-16-phenylhexadeca-5,8,11,14-tetraenamide |
| SMILES | C[C@H](CO)NC(=O)CCC/C=C\C/C=C\C/C=C\C/C=C\Cc1ccccc1 |
| InChI | InChI=1S/C25H35NO2/c1-23(22-27)26-25(28)21-17-12-10-8-6-4-2-3-5-7-9-11-14-18-24-19-15-13-16-20-24/h2,4-5,7-8,10-11,13-16,19-20,23,27H,3,6,9,12,17-18,21-22H2,1H3,(H,26,28)/b4-2-,7-5-,10-8-,14-11-/t23-/m1/s1 |
| InChIKey | FFQDIJKWWKFNQV-CYKTZUFZSA-N |
| XLogP | 5.29 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.56 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|