C10H15N — CID 123163878
7-ethyl-2-methyl-4,5-dihydroazocine (PubChem CID 123163878) has the molecular formula C10H15N and a molecular weight of 149.24 g/mol. Its IUPAC name is 7-ethyl-2-methyl-4,5-dihydroazocine.
| Compound Name | 7-ethyl-2-methyl-4,5-dihydroazocine |
|---|---|
| PubChem CID | 123163878 |
| Molecular Formula | C10H15N |
| Molecular Weight | 149.24 g/mol |
| Exact Mass | 149.12 |
| IUPAC Name | 7-ethyl-2-methyl-4,5-dihydroazocine |
| SMILES | CCC1=CCCC=C(C)/N=C\1 |
| InChI | InChI=1S/C10H15N/c1-3-10-7-5-4-6-9(2)11-8-10/h6-8H,3-5H2,1-2H3/b9-6?,10-7?,11-8- |
| InChIKey | QUOUQSRLHWZEOY-RSYCXSLZSA-N |
| XLogP | 3.09 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.24 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |