C10H15F2N — CID 171492771
(2E)-2-ethylidene-3,3-difluoro-N-prop-1-en-2-ylpentan-1-imine (PubChem CID 171492771) has the molecular formula C10H15F2N and a molecular weight of 187.23 g/mol. Its IUPAC name is (2E)-2-ethylidene-3,3-difluoro-N-prop-1-en-2-ylpentan-1-imine.
| Compound Name | (2E)-2-ethylidene-3,3-difluoro-N-prop-1-en-2-ylpentan-1-imine |
|---|---|
| PubChem CID | 171492771 |
| Molecular Formula | C10H15F2N |
| Molecular Weight | 187.23 g/mol |
| Exact Mass | 187.12 |
| IUPAC Name | (2E)-2-ethylidene-3,3-difluoro-N-prop-1-en-2-ylpentan-1-imine |
| SMILES | C=C(C)/N=C/C(=C\C)C(F)(F)CC |
| InChI | InChI=1S/C10H15F2N/c1-5-9(7-13-8(3)4)10(11,12)6-2/h5,7H,3,6H2,1-2,4H3/b9-5+,13-7+ |
| InChIKey | YRSYRYBEPCTXRB-MHUSLGGSSA-N |
| XLogP | 3.58 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.23 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|