C10H18O5S — CID 123164565
methyl 2-(1,1-dioxothian-4-yl)-3-hydroxybutanoate (PubChem CID 123164565) has the molecular formula C10H18O5S and a molecular weight of 250.32 g/mol. Its IUPAC name is methyl 2-(1,1-dioxothian-4-yl)-3-hydroxybutanoate.
| Compound Name | methyl 2-(1,1-dioxothian-4-yl)-3-hydroxybutanoate |
|---|---|
| PubChem CID | 123164565 |
| Molecular Formula | C10H18O5S |
| Molecular Weight | 250.32 g/mol |
| Exact Mass | 250.09 |
| IUPAC Name | methyl 2-(1,1-dioxothian-4-yl)-3-hydroxybutanoate |
| SMILES | COC(=O)C(C(C)O)C1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C10H18O5S/c1-7(11)9(10(12)15-2)8-3-5-16(13,14)6-4-8/h7-9,11H,3-6H2,1-2H3 |
| InChIKey | XRAOYDARBXQQOE-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.32 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |