C34H39N3O9 — CID 123164638
2-[[4-[(10,19-diethyl-7-hydroxy-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaen-19-yl)oxy]-4-oxobutanoyl]amino]octanoic acid (PubChem CID 123164638) has the molecular formula C34H39N3O9 and a molecular weight of 633.70 g/mol. Its IUPAC name is 2-[[4-[(10,19-diethyl-7-hydroxy-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaen-19-yl)oxy]-4-oxobutanoyl]amino]octanoic acid.
| Compound Name | 2-[[4-[(10,19-diethyl-7-hydroxy-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaen-19-yl)oxy]-4-oxobutanoyl]amino]octanoic acid |
|---|---|
| PubChem CID | 123164638 |
| Molecular Formula | C34H39N3O9 |
| Molecular Weight | 633.70 g/mol |
| Exact Mass | 633.27 |
| IUPAC Name | 2-[[4-[(10,19-diethyl-7-hydroxy-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaen-19-yl)oxy]-4-oxobutanoyl]amino]octanoic acid |
| SMILES | CCCCCCC(NC(=O)CCC(=O)OC1(CC)C(=O)OCc2c1cc1n(c2=O)Cc2c-1nc1ccc(O)cc1c2CC)C(=O)O |
| InChI | InChI=1S/C34H39N3O9/c1-4-7-8-9-10-26(32(42)43)35-28(39)13-14-29(40)46-34(6-3)24-16-27-30-22(17-37(27)31(41)23(24)18-45-33(34)44)20(5-2)21-15-19(38)11-12-25(21)36-30/h11-12,15-16,26,38H,4-10,13-14,17-18H2,1-3H3,(H,35,39)(H,42,43) |
| InChIKey | UZSYUEIBSBGIKF-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 174.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.70 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|