C23H22BN2O5 — CID 58291588
CID 58291588 (PubChem CID 58291588) has the molecular formula C23H22BN2O5 and a molecular weight of 417.25 g/mol.
| Compound Name | CID 58291588 |
|---|---|
| PubChem CID | 58291588 |
| Molecular Formula | C23H22BN2O5 |
| Molecular Weight | 417.25 g/mol |
| Exact Mass | 417.16 |
| IUPAC Name | — |
| SMILES | C[B]O[C@]1(CC)C(=O)OCc2c1cc1n(c2=O)Cc2c-1nc1ccc(O)cc1c2CC |
| InChI | InChI=1S/C23H22BN2O5/c1-4-13-14-8-12(27)6-7-18(14)25-20-15(13)10-26-19(20)9-17-16(21(26)28)11-30-22(29)23(17,5-2)31-24-3/h6-9,27H,4-5,10-11H2,1-3H3/t23-/m0/s1 |
| InChIKey | NONIDKQAQBZIHT-QHCPKHFHSA-N |
| XLogP | 3.04 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.25 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|