C33H31N3O8 — CID 59758183
[(19S)-10,19-diethyl-7-hydroxy-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaen-19-yl] 2-[(4-methylphenyl)methoxycarbonylamino]acetate (PubChem CID 59758183) has the molecular formula C33H31N3O8 and a molecular weight of 597.62 g/mol. Its IUPAC name is [(19S)-10,19-diethyl-7-hydroxy-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaen-19-yl] 2-[(4-methylphenyl)methoxycarbonylamino]acetate.
| Compound Name | [(19S)-10,19-diethyl-7-hydroxy-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaen-19-yl] 2-[(4-methylphenyl)methoxycarbonylamino]acetate |
|---|---|
| PubChem CID | 59758183 |
| Molecular Formula | C33H31N3O8 |
| Molecular Weight | 597.62 g/mol |
| Exact Mass | 597.21 |
| IUPAC Name | [(19S)-10,19-diethyl-7-hydroxy-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaen-19-yl] 2-[(4-methylphenyl)methoxycarbonylamino]acetate |
| SMILES | CCc1c2c(nc3ccc(O)cc13)-c1cc3c(c(=O)n1C2)COC(=O)[C@@]3(CC)OC(=O)CNC(=O)OCc1ccc(C)cc1 |
| InChI | InChI=1S/C33H31N3O8/c1-4-21-22-12-20(37)10-11-26(22)35-29-23(21)15-36-27(29)13-25-24(30(36)39)17-42-31(40)33(25,5-2)44-28(38)14-34-32(41)43-16-19-8-6-18(3)7-9-19/h6-13,37H,4-5,14-17H2,1-3H3,(H,34,41)/t33-/m0/s1 |
| InChIKey | QXZDOCUUIJRKGX-XIFFEERXSA-N |
| XLogP | 4.13 |
| TPSA | 146.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.62 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|