C36H39N3O7Si — CID 142160510
[10-[benzyl(dimethyl)silyl]-19-ethyl-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4,6,8,10,15(20)-heptaen-19-yl] 2-[(2-methylpropan-2-yl)oxycarbonylamino]acetate (PubChem CID 142160510) has the molecular formula C36H39N3O7Si and a molecular weight of 653.81 g/mol. Its IUPAC name is [10-[benzyl(dimethyl)silyl]-19-ethyl-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4,6,8,10,15(20)-heptaen-19-yl] 2-[(2-methylpropan-2-yl)oxycarbonylamino]acetate.
| Compound Name | [10-[benzyl(dimethyl)silyl]-19-ethyl-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4,6,8,10,15(20)-heptaen-19-yl] 2-[(2-methylpropan-2-yl)oxycarbonylamino]acetate |
|---|---|
| PubChem CID | 142160510 |
| Molecular Formula | C36H39N3O7Si |
| Molecular Weight | 653.81 g/mol |
| Exact Mass | 653.26 |
| IUPAC Name | [10-[benzyl(dimethyl)silyl]-19-ethyl-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4,6,8,10,15(20)-heptaen-19-yl] 2-[(2-methylpropan-2-yl)oxycarbonylamino]acetate |
| SMILES | CCC1(OC(=O)CNC(=O)OC(C)(C)C)C(=O)OCc2c1cc1n(c2=O)Cc2c-1nc1ccccc1c2[Si](C)(C)Cc1ccccc1 |
| InChI | InChI=1S/C36H39N3O7Si/c1-7-36(45-29(40)18-37-34(43)46-35(2,3)4)26-17-28-30-24(19-39(28)32(41)25(26)20-44-33(36)42)31(23-15-11-12-16-27(23)38-30)47(5,6)21-22-13-9-8-10-14-22/h8-17H,7,18-21H2,1-6H3,(H,37,43) |
| InChIKey | CJSRXGYNDLUPMX-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 125.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.81 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|