C32H39N3O7Si — CID 142160479
[10-[dimethyl(propyl)silyl]-19-ethyl-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4,6,8,10,15(20)-heptaen-19-yl] 2-[(2-methylpropan-2-yl)oxycarbonylamino]acetate (PubChem CID 142160479) has the molecular formula C32H39N3O7Si and a molecular weight of 605.76 g/mol. Its IUPAC name is [10-[dimethyl(propyl)silyl]-19-ethyl-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4,6,8,10,15(20)-heptaen-19-yl] 2-[(2-methylpropan-2-yl)oxycarbonylamino]acetate.
| Compound Name | [10-[dimethyl(propyl)silyl]-19-ethyl-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4,6,8,10,15(20)-heptaen-19-yl] 2-[(2-methylpropan-2-yl)oxycarbonylamino]acetate |
|---|---|
| PubChem CID | 142160479 |
| Molecular Formula | C32H39N3O7Si |
| Molecular Weight | 605.76 g/mol |
| Exact Mass | 605.26 |
| IUPAC Name | [10-[dimethyl(propyl)silyl]-19-ethyl-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4,6,8,10,15(20)-heptaen-19-yl] 2-[(2-methylpropan-2-yl)oxycarbonylamino]acetate |
| SMILES | CCC[Si](C)(C)c1c2c(nc3ccccc13)-c1cc3c(c(=O)n1C2)COC(=O)C3(CC)OC(=O)CNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C32H39N3O7Si/c1-8-14-43(6,7)27-19-12-10-11-13-23(19)34-26-20(27)17-35-24(26)15-22-21(28(35)37)18-40-29(38)32(22,9-2)41-25(36)16-33-30(39)42-31(3,4)5/h10-13,15H,8-9,14,16-18H2,1-7H3,(H,33,39) |
| InChIKey | DPFZLRXIIBVWBL-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 125.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.76 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|