C33H41N3O7Si — CID 70133872
[19-ethyl-10-[ethyl(dimethyl)silyl]-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4,6,8,10,15(20)-heptaen-19-yl] 4-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate (PubChem CID 70133872) has the molecular formula C33H41N3O7Si and a molecular weight of 619.79 g/mol. Its IUPAC name is [19-ethyl-10-[ethyl(dimethyl)silyl]-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4,6,8,10,15(20)-heptaen-19-yl] 4-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate.
| Compound Name | [19-ethyl-10-[ethyl(dimethyl)silyl]-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4,6,8,10,15(20)-heptaen-19-yl] 4-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate |
|---|---|
| PubChem CID | 70133872 |
| Molecular Formula | C33H41N3O7Si |
| Molecular Weight | 619.79 g/mol |
| Exact Mass | 619.27 |
| IUPAC Name | [19-ethyl-10-[ethyl(dimethyl)silyl]-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4,6,8,10,15(20)-heptaen-19-yl] 4-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate |
| SMILES | CCC1(OC(=O)CCCNC(=O)OC(C)(C)C)C(=O)OCc2c1cc1n(c2=O)Cc2c-1nc1ccccc1c2[Si](C)(C)CC |
| InChI | InChI=1S/C33H41N3O7Si/c1-8-33(42-26(37)15-12-16-34-31(40)43-32(3,4)5)23-17-25-27-21(18-36(25)29(38)22(23)19-41-30(33)39)28(44(6,7)9-2)20-13-10-11-14-24(20)35-27/h10-11,13-14,17H,8-9,12,15-16,18-19H2,1-7H3,(H,34,40) |
| InChIKey | CXTFLKYYAUDUNF-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 125.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.79 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|