C25H26BN2O5 — CID 58332818
CID 58332818 (PubChem CID 58332818) has the molecular formula C25H26BN2O5 and a molecular weight of 445.30 g/mol.
| Compound Name | CID 58332818 |
|---|---|
| PubChem CID | 58332818 |
| Molecular Formula | C25H26BN2O5 |
| Molecular Weight | 445.30 g/mol |
| Exact Mass | 445.19 |
| IUPAC Name | — |
| SMILES | CCC[B]O[C@]1(CC)C(=O)OCc2c1cc1n(c2=O)Cc2c-1nc1ccc(O)cc1c2CC |
| InChI | InChI=1S/C25H26BN2O5/c1-4-9-26-33-25(6-3)19-11-21-22-17(12-28(21)23(30)18(19)13-32-24(25)31)15(5-2)16-10-14(29)7-8-20(16)27-22/h7-8,10-11,29H,4-6,9,12-13H2,1-3H3/t25-/m0/s1 |
| InChIKey | BQUQZDANKSGMLH-VWLOTQADSA-N |
| XLogP | 3.82 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.30 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|