C62H43N5 — CID 123166974
3-[4-[4-(9,9-dimethylfluoren-2-yl)-6-(9,9-dimethylfluoren-3-yl)-1,3,5-triazin-2-yl]phenyl]-6-isocyano-9-naphthalen-2-ylcarbazole (PubChem CID 123166974) has the molecular formula C62H43N5 and a molecular weight of 858.06 g/mol. Its IUPAC name is 3-[4-[4-(9,9-dimethylfluoren-2-yl)-6-(9,9-dimethylfluoren-3-yl)-1,3,5-triazin-2-yl]phenyl]-6-isocyano-9-naphthalen-2-ylcarbazole.
| Compound Name | 3-[4-[4-(9,9-dimethylfluoren-2-yl)-6-(9,9-dimethylfluoren-3-yl)-1,3,5-triazin-2-yl]phenyl]-6-isocyano-9-naphthalen-2-ylcarbazole |
|---|---|
| PubChem CID | 123166974 |
| Molecular Formula | C62H43N5 |
| Molecular Weight | 858.06 g/mol |
| Exact Mass | 857.35 |
| IUPAC Name | 3-[4-[4-(9,9-dimethylfluoren-2-yl)-6-(9,9-dimethylfluoren-3-yl)-1,3,5-triazin-2-yl]phenyl]-6-isocyano-9-naphthalen-2-ylcarbazole |
| SMILES | [C-]#[N+]c1ccc2c(c1)c1cc(-c3ccc(-c4nc(-c5ccc6c(c5)-c5ccccc5C6(C)C)nc(-c5ccc6c(c5)C(C)(C)c5ccccc5-6)n4)cc3)ccc1n2-c1ccc2ccccc2c1 |
| InChI | InChI=1S/C62H43N5/c1-61(2)53-17-11-9-15-47(53)49-34-42(24-29-54(49)61)59-64-58(65-60(66-59)43-23-28-48-46-14-8-10-16-52(46)62(3,4)55(48)35-43)39-20-18-38(19-21-39)41-25-30-56-50(33-41)51-36-44(63-5)26-31-57(51)67(56)45-27-22-37-12-6-7-13-40(37)32-45/h6-36H,1-4H3 |
| InChIKey | SDTRYFYEYKNOPM-UHFFFAOYSA-N |
| XLogP | 15.95 |
| TPSA | 47.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 67 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 858.06 |
| LogP ≤ 5 | 15.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|