C58H39N5O — CID 123363560
3-[4,6-bis(9,9-dimethylfluoren-2-yl)-1,3,5-triazin-2-yl]-9-dibenzofuran-2-yl-6-isocyanocarbazole (PubChem CID 123363560) has the molecular formula C58H39N5O and a molecular weight of 821.98 g/mol. Its IUPAC name is 3-[4,6-bis(9,9-dimethylfluoren-2-yl)-1,3,5-triazin-2-yl]-9-dibenzofuran-2-yl-6-isocyanocarbazole.
| Compound Name | 3-[4,6-bis(9,9-dimethylfluoren-2-yl)-1,3,5-triazin-2-yl]-9-dibenzofuran-2-yl-6-isocyanocarbazole |
|---|---|
| PubChem CID | 123363560 |
| Molecular Formula | C58H39N5O |
| Molecular Weight | 821.98 g/mol |
| Exact Mass | 821.32 |
| IUPAC Name | 3-[4,6-bis(9,9-dimethylfluoren-2-yl)-1,3,5-triazin-2-yl]-9-dibenzofuran-2-yl-6-isocyanocarbazole |
| SMILES | [C-]#[N+]c1ccc2c(c1)c1cc(-c3nc(-c4ccc5c(c4)C(C)(C)c4ccccc4-5)nc(-c4ccc5c(c4)C(C)(C)c4ccccc4-5)n3)ccc1n2-c1ccc2oc3ccccc3c2c1 |
| InChI | InChI=1S/C58H39N5O/c1-57(2)46-15-9-6-12-38(46)40-23-18-34(29-48(40)57)55-60-54(61-56(62-55)35-19-24-41-39-13-7-10-16-47(39)58(3,4)49(41)30-35)33-20-25-50-43(28-33)44-31-36(59-5)21-26-51(44)63(50)37-22-27-53-45(32-37)42-14-8-11-17-52(42)64-53/h6-32H,1-4H3 |
| InChIKey | FWFALYXRFQOJMJ-UHFFFAOYSA-N |
| XLogP | 15.03 |
| TPSA | 61.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 821.98 |
| LogP ≤ 5 | 15.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|