C47H28N4O — CID 140822986
2-isocyano-5-[8-(3-isocyanocarbazol-9-yl)dibenzofuran-2-yl]-12,12-dimethylindeno[1,2-c]carbazole (PubChem CID 140822986) has the molecular formula C47H28N4O and a molecular weight of 664.77 g/mol. Its IUPAC name is 2-isocyano-5-[8-(3-isocyanocarbazol-9-yl)dibenzofuran-2-yl]-12,12-dimethylindeno[1,2-c]carbazole.
| Compound Name | 2-isocyano-5-[8-(3-isocyanocarbazol-9-yl)dibenzofuran-2-yl]-12,12-dimethylindeno[1,2-c]carbazole |
|---|---|
| PubChem CID | 140822986 |
| Molecular Formula | C47H28N4O |
| Molecular Weight | 664.77 g/mol |
| Exact Mass | 664.23 |
| IUPAC Name | 2-isocyano-5-[8-(3-isocyanocarbazol-9-yl)dibenzofuran-2-yl]-12,12-dimethylindeno[1,2-c]carbazole |
| SMILES | [C-]#[N+]c1ccc2c(c1)c1ccccc1n2-c1ccc2oc3ccc(-n4c5ccc([N+]#[C-])cc5c5c6c(ccc54)-c4ccccc4C6(C)C)cc3c2c1 |
| InChI | InChI=1S/C47H28N4O/c1-47(2)38-11-7-5-9-31(38)33-17-20-42-45(46(33)47)37-24-28(49-4)14-19-41(37)51(42)30-16-22-44-36(26-30)35-25-29(15-21-43(35)52-44)50-39-12-8-6-10-32(39)34-23-27(48-3)13-18-40(34)50/h5-26H,1-2H3 |
| InChIKey | WIKOQHAZHIZGFA-UHFFFAOYSA-N |
| XLogP | 13.19 |
| TPSA | 31.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.77 |
| LogP ≤ 5 | 13.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|